EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO |
| Net Charge | 0 |
| Average Mass | 111.144 |
| Monoisotopic Mass | 111.06841 |
| SMILES | CC(=O)C1=NCCC1 |
| InChI | InChI=1S/C6H9NO/c1-5(8)6-3-2-4-7-6/h2-4H2,1H3 |
| InChIKey | DQBQWWSFRPLIAX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acetyl-1-pyrroline (CHEBI:67125) has role flavouring agent (CHEBI:35617) |
| 2-acetyl-1-pyrroline (CHEBI:67125) has role Maillard reaction product (CHEBI:77523) |
| 2-acetyl-1-pyrroline (CHEBI:67125) has role metabolite (CHEBI:25212) |
| 2-acetyl-1-pyrroline (CHEBI:67125) is a acylimine (CHEBI:51516) |
| 2-acetyl-1-pyrroline (CHEBI:67125) is a methyl ketone (CHEBI:51867) |
| 2-acetyl-1-pyrroline (CHEBI:67125) is a pyrroline (CHEBI:23763) |
| IUPAC Name |
|---|
| 1-(3,4-dihydro-2H-pyrrol-5-yl)ethanone |
| Synonyms | Source |
|---|---|
| 2-acetyl-4,5-dihydro-3H-pyrrole | ChEBI |
| 2AP | ChEBI |
| APR | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-Acetyl-1-pyrroline | Wikipedia |
| US4522838 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6321339 | Reaxys |
| Citations |
|---|