EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:67121 - nitroxoline
| Formula | C9H6N2O3 |
| Net Charge | 0 |
| Average Mass | 190.158 |
| Monoisotopic Mass | 190.03784 |
| SMILES | O=[N+]([O-])c1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12H |
| InChIKey | RJIWZDNTCBHXAL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | renal agent A drug used for its effect on the kidneys' regulation of body fluid composition and volume. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitroxoline (CHEBI:67121) has role antifungal agent (CHEBI:35718) |
| nitroxoline (CHEBI:67121) has role antiinfective agent (CHEBI:35441) |
| nitroxoline (CHEBI:67121) has role antimicrobial agent (CHEBI:33281) |
| nitroxoline (CHEBI:67121) has role renal agent (CHEBI:35846) |
| nitroxoline (CHEBI:67121) is a C-nitro compound (CHEBI:35716) |
| nitroxoline (CHEBI:67121) is a monohydroxyquinoline (CHEBI:38775) |
| IUPAC Name |
|---|
| 5-nitroquinolin-8-ol |
| INNs | Source |
|---|---|
| nitroxolinum | ChemIDplus |
| nitroxolina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5NOK | ChemIDplus |
| 5-NOK | ChemIDplus |
| 5-Nitro-8-oxyquinoline | ChemIDplus |
| 8-Hydroxy-5-nitroquinoline | ChemIDplus |
| 5-Nitro-8-hydroxyquinoline | ChemIDplus |
| 5-Nitrox | ChemIDplus |
| Citations |
|---|