EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:67121 - nitroxoline
| Formula | C9H6N2O3 |
| Net Charge | 0 |
| Average Mass | 190.158 |
| Monoisotopic Mass | 190.03784 |
| SMILES | O=[N+]([O-])c1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12H |
| InChIKey | RJIWZDNTCBHXAL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | renal agent A drug used for its effect on the kidneys' regulation of body fluid composition and volume. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitroxoline (CHEBI:67121) has role antifungal agent (CHEBI:35718) |
| nitroxoline (CHEBI:67121) has role antiinfective agent (CHEBI:35441) |
| nitroxoline (CHEBI:67121) has role antimicrobial agent (CHEBI:33281) |
| nitroxoline (CHEBI:67121) has role renal agent (CHEBI:35846) |
| nitroxoline (CHEBI:67121) is a C-nitro compound (CHEBI:35716) |
| nitroxoline (CHEBI:67121) is a monohydroxyquinoline (CHEBI:38775) |
| IUPAC Name |
|---|
| 5-nitroquinolin-8-ol |
| INNs | Source |
|---|---|
| nitroxolina | ChemIDplus |
| nitroxolinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Nitro-8-hydroxyquinoline | ChemIDplus |
| 5-Nitro-8-oxyquinoline | ChemIDplus |
| 5-Nitro-8-quinolinol | ChemIDplus |
| 5-Nitrox | ChemIDplus |
| 5-NOK | ChemIDplus |
| 5NOK | ChemIDplus |
| Citations |
|---|