EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6712 - Meclofenoxate
| Formula | C12H16ClNO3 |
| Net Charge | 0 |
| Average Mass | 257.717 |
| Monoisotopic Mass | 257.08187 |
| SMILES | CN(C)CCOC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO3/c1-14(2)7-8-16-12(15)9-17-11-5-3-10(13)4-6-11/h3-6H,7-9H2,1-2H3 |
| InChIKey | XZTYGFHCIAKPGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Meclofenoxate (CHEBI:6712) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| meclofenoxane | DrugCentral |
| Meclofenoxate | KEGG COMPOUND |
| meclofenoxate HCl | DrugCentral |
| meclofenoxate hydrochloride | DrugCentral |
| meclophenoxate | DrugCentral |