EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO3 |
| Net Charge | 0 |
| Average Mass | 197.234 |
| Monoisotopic Mass | 197.10519 |
| SMILES | [H][C@]12CC[C@]([H])([C@@H](C(=O)OC)C(=O)C1)N2C |
| InChI | InChI=1S/C10H15NO3/c1-11-6-3-4-7(11)9(8(12)5-6)10(13)14-2/h6-7,9H,3-5H2,1-2H3/t6-,7+,9+/m0/s1 |
| InChIKey | WXEMSGQRTGSYOG-LKEWCRSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ecgonone methyl ester (CHEBI:67115) is a cyclic ketone (CHEBI:3992) |
| ecgonone methyl ester (CHEBI:67115) is a methyl ester (CHEBI:25248) |
| ecgonone methyl ester (CHEBI:67115) is a organic heterobicyclic compound (CHEBI:27171) |
| ecgonone methyl ester (CHEBI:67115) is a tertiary amino compound (CHEBI:50996) |
| ecgonone methyl ester (CHEBI:67115) is a tropane alkaloid (CHEBI:37332) |
| ecgonone methyl ester (CHEBI:67115) is conjugate base of ecgononium methyl ester(1+) (CHEBI:66941) |
| Incoming Relation(s) |
| ecgononium methyl ester(1+) (CHEBI:66941) is conjugate acid of ecgonone methyl ester (CHEBI:67115) |
| IUPAC Name |
|---|
| methyl (1R,2R,5S)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7204103 | Reaxys |