EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:67113 |
| ChEBI Name | chlorantraniliprole |
| Stars | |
| Definition | A carboxamide resulting from the formal condensation of the carboxylic acid group of 3-bromo-1-(3-chloropyridin-2-yl)-1H-pyrazole-5-carboxylic acid with the primary amino group of 2-amino-5-chloro-N,3-dimethylbenzamide. The first of the anthranilic diamide insecticides, it is a ryanodine receptor activator and is used to protect a wide variety of crops, including corn, cotton, grapes, rice and potatoes. |
| Last Modified | 25 February 2020 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C18H14BrCl2N5O2 |
| Net Charge | 0 |
| Average Mass | 483.153 |
| Monoisotopic Mass | 480.97079 |
| SMILES | CNC(=O)c1cc(Cl)cc(C)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C18H14BrCl2N5O2/c1-9-6-10(20)7-11(17(27)22-2)15(9)24-18(28)13-8-14(19)25-26(13)16-12(21)4-3-5-23-16/h3-8H,1-2H3,(H,22,27)(H,24,28) |
| InChIKey | PSOVNZZNOMJUBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | ryanodine receptor agonist A ryanodine receptor modulator which activates the receptor. Ryanodine receptors (RyRs) act as selective ion channels, modulating the release of calcium. Activating the receptors causes the release of calcium, so depleting internal calcium and ultimately preventing further muscle contraction. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorantraniliprole (CHEBI:67113) has role ryanodine receptor agonist (CHEBI:67114) |
| chlorantraniliprole (CHEBI:67113) is a monochlorobenzenes (CHEBI:83403) |
| chlorantraniliprole (CHEBI:67113) is a organobromine compound (CHEBI:37141) |
| chlorantraniliprole (CHEBI:67113) is a pyrazole insecticide (CHEBI:26409) |
| chlorantraniliprole (CHEBI:67113) is a pyrazoles (CHEBI:26410) |
| chlorantraniliprole (CHEBI:67113) is a pyridines (CHEBI:26421) |
| chlorantraniliprole (CHEBI:67113) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 3-bromo-N-[4-chloro-2-methyl-6-(methylcarbamoyl)phenyl]-1-(3-chloropyridin-2-yl)-1H-pyrazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| 3-bromo-N-{4-chloro-2-methyl-6-[(methylamino)carbonyl]phenyl}-1-(3-chloro-2-pyridinyl)-1H-pyrazole-5-carboxamide | ChemIDplus |
| DPX-E2Y45 | ChEBI |
| Brand Name | Source |
|---|---|
| Rynaxpyr | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11247880 | Reaxys |
| CAS:500008-45-7 | ChemIDplus |
| CAS:500008-45-7 | KEGG COMPOUND |
| Citations |
|---|