EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O4 |
| Net Charge | 0 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02661 |
| SMILES | [H]C(=O)/C=C\C=C(\O)C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-4-2-1-3-5(8)6(9)10/h1-4,8H,(H,9,10)/b2-1-,5-3+ |
| InChIKey | KGLCZTRXNNGESL-REDYYMJGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4Z)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:67110) is a 2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:17236) |
| (2E,4Z)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:67110) is conjugate acid of (2E,4Z)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:66943) |
| Incoming Relation(s) |
| (2E,4Z)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:66943) is conjugate base of (2E,4Z)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:67110) |
| IUPAC Name |
|---|
| (2E,4Z)-2-hydroxy-6-oxohexa-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxymuconic semialdehyde | ChEBI |
| 2-Hydroxymuconic semialdehyde | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00682 | KEGG COMPOUND |
| HYDROXYMUCONATE-SALD | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1929226 | Reaxys |
| CAS:3270-98-2 | KEGG COMPOUND |