EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H39NO |
| Net Charge | 0 |
| Average Mass | 285.516 |
| Monoisotopic Mass | 285.30316 |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)[C@H](C)N |
| InChI | InChI=1S/C18H39NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(20)17(2)19/h17-18,20H,3-16,19H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | YRYJJIXWWQLGGV-ZWKOTPCHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxysphinganine (CHEBI:67106) has functional parent sphinganine (CHEBI:16566) |
| 1-deoxysphinganine (CHEBI:67106) has role antineoplastic agent (CHEBI:35610) |
| 1-deoxysphinganine (CHEBI:67106) is a amino alcohol (CHEBI:22478) |
| 1-deoxysphinganine (CHEBI:67106) is a sphingoid (CHEBI:35785) |
| 1-deoxysphinganine (CHEBI:67106) is conjugate base of 1-deoxysphinganine(1+) (CHEBI:67109) |
| Incoming Relation(s) |
| 1-deoxysphinga-6Z,9Z,12Z,15Z-tetraenine (CHEBI:73892) has functional parent 1-deoxysphinganine (CHEBI:67106) |
| 1-deoxysphinganine(1+) (CHEBI:67109) is conjugate acid of 1-deoxysphinganine (CHEBI:67106) |
| IUPAC Name |
|---|
| (2S,3R)-2-aminooctadecan-3-ol |
| Synonyms | Source |
|---|---|
| 1-deoxy-sphinganine | LIPID MAPS |
| (2S,3R)-2-amino-3-hydroxyoctadecane | ChEBI |
| Spisulosine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| EP1069894 | Patent |
| LMSP01080032 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722974 | Reaxys |
| Citations |
|---|