EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N.HCl |
| Net Charge | 0 |
| Average Mass | 203.757 |
| Monoisotopic Mass | 203.14408 |
| SMILES | CNC1(C)C2CCC(C2)C1(C)C.Cl |
| InChI | InChI=1S/C11H21N.ClH/c1-10(2)8-5-6-9(7-8)11(10,3)12-4;/h8-9,12H,5-7H2,1-4H3;1H |
| InChIKey | PKVZBNCYEICAQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mecamylamine hydrochloride (CHEBI:6707) has role antidepressant (CHEBI:35469) |
| Mecamylamine hydrochloride (CHEBI:6707) is a monoterpenoid (CHEBI:25409) |
| Synonyms | Source |
|---|---|
| Inversine (TN) | KEGG COMPOUND |
| Mecamylamine hydrochloride | KEGG COMPOUND |
| NSC-757086 | ChEMBL |
| Brand Name | Source |
|---|---|
| Inversine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00611 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:826-39-1 | KEGG COMPOUND |
| Citations |
|---|