EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13N3O3 |
| Net Charge | 0 |
| Average Mass | 295.298 |
| Monoisotopic Mass | 295.09569 |
| SMILES | COC(=O)Nc1nc2ccc(C(=O)c3ccccc3)cc2n1 |
| InChI | InChI=1S/C16H13N3O3/c1-22-16(21)19-15-17-12-8-7-11(9-13(12)18-15)14(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,17,18,19,21) |
| InChIKey | OPXLLQIJSORQAM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. |
| Application: | antinematodal drug A substance used in the treatment or control of nematode infestations. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mebendazole (CHEBI:6704) has parent hydride 1H-benzimidazole (CHEBI:41275) |
| mebendazole (CHEBI:6704) has role antinematodal drug (CHEBI:35444) |
| mebendazole (CHEBI:6704) has role microtubule-destabilising agent (CHEBI:61951) |
| mebendazole (CHEBI:6704) has role tubulin modulator (CHEBI:60832) |
| mebendazole (CHEBI:6704) is a aromatic ketone (CHEBI:76224) |
| mebendazole (CHEBI:6704) is a benzimidazoles (CHEBI:22715) |
| mebendazole (CHEBI:6704) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| methyl (5-benzoyl-1H-benzimidazol-2-yl)carbamate |
| Synonyms | Source |
|---|---|
| (5-benzoyl-1H-benzimidazol-2-yl)-carbamic acid methyl ester | ChemIDplus |
| MBDZ | ChemIDplus |
| Mebendazole | KEGG COMPOUND |
| Vermox | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1641 | DrugCentral |
| D00368 | KEGG DRUG |
| DB00643 | DrugBank |
| LSM-3749 | LINCS |
| Mebendazole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:759809 | Reaxys |
| CAS:31431-39-7 | ChemIDplus |
| Citations |
|---|