EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O4 |
| Net Charge | -1 |
| Average Mass | 359.486 |
| Monoisotopic Mass | 359.22278 |
| SMILES | CCCCCc1cc(O)c(C/C=C(/C)CCC=C(C)C)c(O)c1C(=O)[O-] |
| InChI | InChI=1S/C22H32O4/c1-5-6-7-11-17-14-19(23)18(21(24)20(17)22(25)26)13-12-16(4)10-8-9-15(2)3/h9,12,14,23-24H,5-8,10-11,13H2,1-4H3,(H,25,26)/p-1/b16-12- |
| InChIKey | SEEZIOZEUUMJME-VBKFSLOCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cannabinerolate (CHEBI:66961) has functional parent olivetolate (CHEBI:66950) |
| cannabinerolate (CHEBI:66961) is a dihydroxybenzoate (CHEBI:36084) |
| cannabinerolate (CHEBI:66961) is conjugate base of cannabinerolic acid (CHEBI:67080) |
| Incoming Relation(s) |
| cannabinerolic acid (CHEBI:67080) is conjugate acid of cannabinerolate (CHEBI:66961) |
| IUPAC Name |
|---|
| 3-[(2Z)-3,7-dimethylocta-2,6-dien-1-yl]-2,4-dihydroxy-6-pentylbenzoate |
| Synonyms | Source |
|---|---|
| cannabinerolate(1−) | ChEBI |
| cannabinerolate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| cannabinerolate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7175 | MetaCyc |
| Citations |
|---|