EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | CCCCCC(=O)Cc1cc(O)cc(=O)o1 |
| InChI | InChI=1S/C12H16O4/c1-2-3-4-5-9(13)6-11-7-10(14)8-12(15)16-11/h7-8,14H,2-6H2,1H3 |
| InChIKey | GHURLXDGHMZIGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-6-(2-oxoheptyl)pyran-2-one (CHEBI:66959) has role metabolite (CHEBI:25212) |
| 4-hydroxy-6-(2-oxoheptyl)pyran-2-one (CHEBI:66959) is a 2-pyranones (CHEBI:75885) |
| 4-hydroxy-6-(2-oxoheptyl)pyran-2-one (CHEBI:66959) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 4-hydroxy-6-(2-oxoheptyl)-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| 4-hydroxy-6-(2-oxoheptyl)-2-pyranone | ChEBI |
| hexanoyltriacetic acid lactone | ChEBI |
| HTAL | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9915653 | Reaxys |
| Citations |
|---|