EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3NO7 |
| Net Charge | -2 |
| Average Mass | 213.101 |
| Monoisotopic Mass | 212.99205 |
| SMILES | O=C([O-])/C=C/C(=C\C(=O)C(=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO7/c9-5(7(12)13)3-4(8(14)15)1-2-6(10)11/h1-3H,(H,10,11)(H,12,13)/p-2/b2-1+,4-3+ |
| InChIKey | WQSLVSOAROUIFS-MVJNYCIBSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitro-6-oxohepta-2,4-dienedioate (CHEBI:66945) is a dicarboxylic acid dianion (CHEBI:28965) |
| 4-nitro-6-oxohepta-2,4-dienedioate (CHEBI:66945) is conjugate base of 4-nitro-6-oxohepta-2,4-dienedioic acid (CHEBI:67104) |
| Incoming Relation(s) |
| 4-nitro-6-oxohepta-2,4-dienedioic acid (CHEBI:67104) is conjugate acid of 4-nitro-6-oxohepta-2,4-dienedioate (CHEBI:66945) |
| IUPAC Name |
|---|
| (2E,4E)-4-nitro-6-oxohepta-2,4-dienedioate |
| UniProt Name | Source |
|---|---|
| 4-nitro-6-oxohepta-2,4-dienedioate | UniProt |
| Citations |
|---|