EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=C1/C(=C/c2ccc(O)c(O)c2)Oc2c1ccc(O)c2O |
| InChI | InChI=1S/C15H10O6/c16-9-3-1-7(5-11(9)18)6-12-13(19)8-2-4-10(17)14(20)15(8)21-12/h1-6,16-18,20H/b12-6- |
| InChIKey | PNIFOHGQPKXLJE-SDQBBNPISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bidens bipinnata (ncbitaxon:1527831) | whole plant (BTO:0001461) | PubMed (25282892) | |
| Coreopsis tinctoria (ncbitaxon:41554) | - | PubMed (25516207) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maritimetin (CHEBI:6694) has functional parent aurone (CHEBI:47964) |
| maritimetin (CHEBI:6694) has role plant metabolite (CHEBI:76924) |
| maritimetin (CHEBI:6694) has role radical scavenger (CHEBI:48578) |
| maritimetin (CHEBI:6694) is a hydroxyaurone (CHEBI:85970) |
| IUPAC Name |
|---|
| (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6,7-dihydroxy-1-benzofuran-3(2H)-one |
| Manual Xrefs | Databases |
|---|---|
| C00008029 | KNApSAcK |
| C08720 | KEGG COMPOUND |
| HMDB0029711 | HMDB |
| LMPK12130020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:35356 | Reaxys |
| CAS:576-02-3 | KEGG COMPOUND |
| Citations |
|---|