EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O6 |
| Net Charge | 0 |
| Average Mass | 214.173 |
| Monoisotopic Mass | 214.04774 |
| SMILES | O=C(O)CCC(=O)/C=C/C=C(\O)C(=O)O |
| InChI | InChI=1S/C9H10O6/c10-6(4-5-8(12)13)2-1-3-7(11)9(14)15/h1-3,11H,4-5H2,(H,12,13)(H,14,15)/b2-1+,7-3- |
| InChIKey | RFENOVFRMPRRJI-YDCWOTKKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4E)-2-hydroxy-6-oxonona-2,4-dienedioic acid (CHEBI:66936) is a 2-hydroxy-6-oxonona-2,4-dienedioic acid (CHEBI:17367) |
| (2Z,4E)-2-hydroxy-6-oxonona-2,4-dienedioic acid (CHEBI:66936) is conjugate acid of (2Z,4E)-2-hydroxy-6-oxonona-2,4-dienedioate(2−) (CHEBI:66887) |
| Incoming Relation(s) |
| (2Z,4E)-2-hydroxy-6-oxonona-2,4-dienedioate(2−) (CHEBI:66887) is conjugate base of (2Z,4E)-2-hydroxy-6-oxonona-2,4-dienedioic acid (CHEBI:66936) |
| IUPAC Name |
|---|
| (2Z,4E)-2-hydroxy-6-oxonona-2,4-dienedioic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6923341 | Reaxys |