EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N3O2 |
| Net Charge | 0 |
| Average Mass | 153.141 |
| Monoisotopic Mass | 153.05383 |
| SMILES | NNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C6H7N3O2/c7-8-5-1-3-6(4-2-5)9(10)11/h1-4,8H,7H2 |
| InChIKey | KMVPXBDOWDXXEN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrophenylhydrazine (CHEBI:66931) has functional parent phenylhydrazine (CHEBI:27924) |
| 4-nitrophenylhydrazine (CHEBI:66931) has role mutagen (CHEBI:25435) |
| 4-nitrophenylhydrazine (CHEBI:66931) is a C-nitro compound (CHEBI:35716) |
| 4-nitrophenylhydrazine (CHEBI:66931) is a phenylhydrazines (CHEBI:25996) |
| IUPAC Name |
|---|
| (4-nitrophenyl)hydrazine |
| Synonyms | Source |
|---|---|
| p-Hydrazinonitrobenzene | ChemIDplus |
| p-Nitrophenylhydrazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101143835 | Patent |
| PND | PDBeChem |
| Citations |
|---|