EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N6.H3O4P |
| Net Charge | 0 |
| Average Mass | 404.367 |
| Monoisotopic Mass | 404.13619 |
| SMILES | N#CC[C@H](C1CCCC1)n1cc(-c2ncnc3nccc23)cn1.O=P(O)(O)O |
| InChI | InChI=1S/C17H18N6.H3O4P/c18-7-5-15(12-3-1-2-4-12)23-10-13(9-22-23)16-14-6-8-19-17(14)21-11-20-16;1-5(2,3)4/h6,8-12,15H,1-5H2,(H,19,20,21);(H3,1,2,3,4)/t15-;/m1./s1 |
| InChIKey | JFMWPOCYMYGEDM-XFULWGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ruxolitinib phosphate (CHEBI:66917) has part ruxolitinib (CHEBI:66919) |
| ruxolitinib phosphate (CHEBI:66917) has role antineoplastic agent (CHEBI:35610) |
| ruxolitinib phosphate (CHEBI:66917) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| ruxolitinib phosphate (CHEBI:66917) is a phosphate salt (CHEBI:37853) |
| IUPAC Name |
|---|
| (3R)-3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl]propanenitrile phosphate |
| Brand Name | Source |
|---|---|
| Jakafi | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09960 | KEGG DRUG |
| US2008312259 | Patent |
| US2010190981 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18762556 | Reaxys |
| CAS:1092939-17-7 | ChemIDplus |
| CAS:1092939-17-7 | KEGG DRUG |
| Citations |
|---|