EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O11 |
| Net Charge | 0 |
| Average Mass | 450.396 |
| Monoisotopic Mass | 450.11621 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)c1c(O)cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C21H22O11/c22-8-16-18(28)19(29)20(30)21(32-16)31-10-6-14(26)17(15(27)7-10)12(24)4-2-9-1-3-11(23)13(25)5-9/h1-7,16,18-23,25-30H,8H2/b4-2+/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GZTXEEPKLNRIEL-LYXDKPSQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside (CHEBI:66904) has functional parent 2',3,4,4',6'-pentahydroxychalcone (CHEBI:10836) |
| 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside (CHEBI:66904) is a β-D-glucoside (CHEBI:22798) |
| 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside (CHEBI:66904) is conjugate acid of 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside(1−) (CHEBI:77622) |
| Incoming Relation(s) |
| 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside(1−) (CHEBI:77622) is conjugate base of 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside (CHEBI:66904) |
| IUPAC Name |
|---|
| 4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-3,5-dihydroxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2',3,4,4',6'-Pentahydroxychalcone 4'-O-glucoside | KEGG DRUG |
| PHC 4'-O-glucoside | KEGG COMPOUND |
| PHC 4'-O-glucoside | KEGG DRUG |
| Citations |
|---|