EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14Cl2N2O3S |
| Net Charge | 0 |
| Average Mass | 421.305 |
| Monoisotopic Mass | 420.01022 |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H14Cl2N2O3S/c1-27(25,26)13-6-7-14(17(21)11-13)19(24)23-12-5-8-16(20)15(10-12)18-4-2-3-9-22-18/h2-11H,1H3,(H,23,24) |
| InChIKey | BPQMGSKTAYIVFO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Hedgehog signaling pathway inhibitor Any pathway inhibitor that inhibits the Hedgehog signalling pathway. SMO receptor antagonist An antagonist that interferes with the action of smoothened (SMO) receptor. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vismodegib (CHEBI:66903) has role antineoplastic agent (CHEBI:35610) |
| vismodegib (CHEBI:66903) has role Hedgehog signaling pathway inhibitor (CHEBI:140921) |
| vismodegib (CHEBI:66903) has role SMO receptor antagonist (CHEBI:66908) |
| vismodegib (CHEBI:66903) has role teratogenic agent (CHEBI:50905) |
| vismodegib (CHEBI:66903) is a benzamides (CHEBI:22702) |
| vismodegib (CHEBI:66903) is a monochlorobenzenes (CHEBI:83403) |
| vismodegib (CHEBI:66903) is a pyridines (CHEBI:26421) |
| vismodegib (CHEBI:66903) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 2-chloro-N-[4-chloro-3-(pyridin-2-yl)phenyl]-4-(methylsulfonyl)benzamide |
| INNs | Source |
|---|---|
| vismodegib | KEGG DRUG |
| vismodegib | WHO MedNet |
| vismodégib | WHO MedNet |
| vismodegibum | WHO MedNet |
| Brand Name | Source |
|---|---|
| Erivedge | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4227 | DrugCentral |
| Vismodegib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12532124 | Reaxys |
| CAS:879085-55-9 | KEGG DRUG |
| CAS:879085-55-9 | ChemIDplus |
| Citations |
|---|