EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N |
| Net Charge | 0 |
| Average Mass | 277.411 |
| Monoisotopic Mass | 277.18305 |
| SMILES | CNCCCC12CCC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C20H23N/c1-21-14-6-12-20-13-11-15(16-7-2-4-9-18(16)20)17-8-3-5-10-19(17)20/h2-5,7-10,15,21H,6,11-14H2,1H3 |
| InChIKey | QSLMDECMDJKHMQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maprotiline (CHEBI:6690) has role antidepressant (CHEBI:35469) |
| Maprotiline (CHEBI:6690) has role antineoplastic agent (CHEBI:35610) |
| Maprotiline (CHEBI:6690) has role antipsychotic agent (CHEBI:35476) |
| Maprotiline (CHEBI:6690) has role anxiolytic drug (CHEBI:35474) |
| Maprotiline (CHEBI:6690) is a anthracenes (CHEBI:46955) |
| INN | Source |
|---|---|
| maprotilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| BA-34,276 [AS HYDROCHLORIDE] | ChEMBL |
| BA-34,276 FREE BASE | ChEMBL |
| BA-34276 FREE BASE | ChEMBL |
| Maprotiline | KEGG COMPOUND |
| maprotiline HCl | DrugCentral |
| maprotiline hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1634 | DrugCentral |
| C07107 | KEGG COMPOUND |
| D02566 | KEGG DRUG |
| HMDB0015069 | HMDB |
| LSM-2043 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:10262-69-8 | KEGG COMPOUND |
| Citations |
|---|