EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N |
| Net Charge | 0 |
| Average Mass | 107.156 |
| Monoisotopic Mass | 107.07350 |
| SMILES | Cc1ccccc1N |
| InChI | InChI=1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5H,8H2,1H3 |
| InChIKey | RNVCVTLRINQCPJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-toluidine (CHEBI:66892) has role carcinogenic agent (CHEBI:50903) |
| o-toluidine (CHEBI:66892) is a aminotoluene (CHEBI:22531) |
| Incoming Relation(s) |
| 5-nitro-o-toluidine (CHEBI:66891) has functional parent o-toluidine (CHEBI:66892) |
| IUPAC Name |
|---|
| 2-methylaniline |
| Synonyms | Source |
|---|---|
| 1-Amino-2-methylbenzene | ChemIDplus |
| 1-Methyl-2-aminobenzene | ChemIDplus |
| 2-Amino-1-methylbenzene | ChemIDplus |
| 2-Aminotoluene | KEGG COMPOUND |
| 2-Aminotoluene | ChemIDplus |
| 2-Methyl-1-aminobenzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14403 | KEGG COMPOUND |
| HMDB0041965 | HMDB |
| Citations |
|---|