EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N2O3 |
| Net Charge | 0 |
| Average Mass | 359.432 |
| Monoisotopic Mass | 359.18746 |
| SMILES | CNc1ccc(/C=C/c2ccc(OCCOCCOCC[18F])nc2)cc1 |
| InChI | InChI=1S/C20H25FN2O3/c1-22-19-7-4-17(5-8-19)2-3-18-6-9-20(23-16-18)26-15-14-25-13-12-24-11-10-21/h2-9,16,22H,10-15H2,1H3/b3-2+/i21-1 |
| InChIKey | YNDIAUKFXKEXSV-CRYLGTRXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiopharmaceutical Any pharmaceutical compound containing a radioisotope. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| florbetapir F-18 (CHEBI:66880) has role antineoplastic agent (CHEBI:35610) |
| florbetapir F-18 (CHEBI:66880) has role immunosuppressive agent (CHEBI:35705) |
| florbetapir F-18 (CHEBI:66880) has role radioactive imaging agent (CHEBI:37336) |
| florbetapir F-18 (CHEBI:66880) is a 18F radiopharmaceutical (CHEBI:49127) |
| florbetapir F-18 (CHEBI:66880) is a aromatic ether (CHEBI:35618) |
| florbetapir F-18 (CHEBI:66880) is a organofluorine compound (CHEBI:37143) |
| florbetapir F-18 (CHEBI:66880) is a pyridines (CHEBI:26421) |
| florbetapir F-18 (CHEBI:66880) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-{(E)-2-[6-(2-{2-[2-(18F)fluoroethoxy]ethoxy}ethoxy)pyridin-3-yl]ethenyl}-N-methylaniline |
| Synonyms | Source |
|---|---|
| 18f-av45 | ChEMBL |
| (18F)AV-45 | ChEMBL |
| 18F-AV-45 | ChEMBL |
| Av45 f-18 | ChEMBL |
| AV-45 F-18 | ChEMBL |
| Florbetapir | ChemIDplus |
| Brand Name | Source |
|---|---|
| Amyvid | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:956103-76-7 | ChemIDplus |
| CAS:956103-76-7 | KEGG DRUG |
| Citations |
|---|