EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2Na.O4S2 |
| Net Charge | 0 |
| Average Mass | 174.110 |
| Monoisotopic Mass | 173.90334 |
| SMILES | O=S([O-])S(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/2Na.H2O4S2/c;;1-5(2)6(3)4/h;;(H,1,2)(H,3,4)/q2*+1;/p-2 |
| InChIKey | JVBXVOWTABLYPX-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Application: | bleaching agent A reagent that lightens or whitens a substrate through chemical reaction. Bleaching reactions usually involve oxidative or reductive processes that degrade colour systems. Bleaching can occur by destroying one or more of the double bonds in the conjugated chain, by cleaving the conjugated chain, or by oxidation of one of the other moieties in the conjugated chain. Their reactivity results in many bleaches having strong bactericidal, disinfecting, and sterilising properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium dithionite (CHEBI:66870) has part dithionite(2−) (CHEBI:42160) |
| sodium dithionite (CHEBI:66870) has role bleaching agent (CHEBI:132717) |
| sodium dithionite (CHEBI:66870) has role reducing agent (CHEBI:63247) |
| sodium dithionite (CHEBI:66870) is a inorganic sodium salt (CHEBI:38702) |
| IUPAC Name |
|---|
| disodium dithionite |
| Synonyms | Source |
|---|---|
| sodium hydrosulfite | SUBMITTER |
| sodium sulfoxylate | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Sodium_dithionite | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1210429 | Reaxys |
| CAS:7775-14-6 | SUBMITTER |
| CAS:7775-14-6 | ChemIDplus |