EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O6 |
| Net Charge | 0 |
| Average Mass | 344.363 |
| Monoisotopic Mass | 344.12599 |
| SMILES | CC1(C)OC(COc2c3ccoc3cc3oc(=O)ccc23)C(C)(C)O1 |
| InChI | InChI=1S/C19H20O6/c1-18(2)15(24-19(3,4)25-18)10-22-17-11-5-6-16(20)23-14(11)9-13-12(17)7-8-21-13/h5-9,15H,10H2,1-4H3 |
| InChIKey | XIIINVJICGOJHC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica dahurica (ncbitaxon:48101) | root (BTO:0001188) | PubMed (15646793) | |
| Peucedanum turcomanicum (IPNI:846497-1) | - | Article (KHIM PRIR SOEDIN, 1979, 6, 847) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxypeucedanin hydrate acetonide (CHEBI:66843) has role antineoplastic agent (CHEBI:35610) |
| oxypeucedanin hydrate acetonide (CHEBI:66843) has role metabolite (CHEBI:25212) |
| oxypeucedanin hydrate acetonide (CHEBI:66843) is a aromatic ether (CHEBI:35618) |
| oxypeucedanin hydrate acetonide (CHEBI:66843) is a dioxolane (CHEBI:39430) |
| oxypeucedanin hydrate acetonide (CHEBI:66843) is a furanocoumarin (CHEBI:24128) |
| IUPAC Name |
|---|
| 4-[(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)methoxy]-7H-furo[3,2-g]chromen-7-one |
| Citations |
|---|