EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H11NO5 |
| Net Charge | 0 |
| Average Mass | 321.288 |
| Monoisotopic Mass | 321.06372 |
| SMILES | COc1c(O)ccc2c1-c1c3c(cc4ccnc(c14)C2=O)OCO3 |
| InChI | InChI=1S/C18H11NO5/c1-22-17-10(20)3-2-9-13(17)14-12-8(4-5-19-15(12)16(9)21)6-11-18(14)24-7-23-11/h2-6,20H,7H2,1H3 |
| InChIKey | IVWNIIWOWTWWKH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hernandia nymphaeifolia (ncbitaxon:121082) | stem (BTO:0001300) | DOI (10.1021/np960034d) | Previous component: stem bark; |
| Lindera chunii (ncbitaxon:344093) | root (BTO:0001188) | PubMed (12237535) |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-oxohernangerine (CHEBI:66841) has functional parent aporphine (CHEBI:35643) |
| 7-oxohernangerine (CHEBI:66841) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| 7-oxohernangerine (CHEBI:66841) has role metabolite (CHEBI:25212) |
| 7-oxohernangerine (CHEBI:66841) is a aromatic ether (CHEBI:35618) |
| 7-oxohernangerine (CHEBI:66841) is a cyclic ketone (CHEBI:3992) |
| 7-oxohernangerine (CHEBI:66841) is a organic heteropentacyclic compound (CHEBI:38164) |
| 7-oxohernangerine (CHEBI:66841) is a oxacycle (CHEBI:38104) |
| 7-oxohernangerine (CHEBI:66841) is a oxoaporphine alkaloid (CHEBI:132998) |
| 7-oxohernangerine (CHEBI:66841) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 11-hydroxy-12-methoxy-8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9286227 | Reaxys |
| Citations |
|---|