EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COC(=O)c1c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C16H12O7/c1-22-16(21)14-13-11(20)5-8(17)6-12(13)23-15(14)7-2-3-9(18)10(19)4-7/h2-6,17-20H,1H3 |
| InChIKey | BVFAKXZUPQTNKN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (15516765) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oryzafuran (CHEBI:66837) has role antioxidant (CHEBI:22586) |
| oryzafuran (CHEBI:66837) has role metabolite (CHEBI:25212) |
| oryzafuran (CHEBI:66837) is a 1-benzofurans (CHEBI:38830) |
| oryzafuran (CHEBI:66837) is a carboxylic ester (CHEBI:33308) |
| oryzafuran (CHEBI:66837) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| methyl 2-(3,4-dihydroxyphenyl)-4,6-dihydroxy-1-benzofuran-3-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| KR20060090019 | Patent |
| KR20070103124 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9944192 | Reaxys |
| Citations |
|---|