EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H32N2O8 |
| Net Charge | 0 |
| Average Mass | 620.658 |
| Monoisotopic Mass | 620.21587 |
| SMILES | CC1(C)CC(c2c3c(c4nc5c(O)cccc5c(=O)c4c2O)CCC(C)(C)O3)c2c(cc(O)c3c(=O)c4cccc(O)c4nc23)O1 |
| InChI | InChI=1S/C36H32N2O8/c1-35(2)12-11-17-29-26(32(43)16-8-6-9-19(39)27(16)37-29)33(44)24(34(17)46-35)18-14-36(3,4)45-22-13-21(41)25-30(23(18)22)38-28-15(31(25)42)7-5-10-20(28)40/h5-10,13,18,39-41,44H,11-12,14H2,1-4H3,(H,37,43)(H,38,42) |
| InChIKey | YPOUKZJOAMKOEN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oriciopsis glaberrima (IPNI:774491-1) | stem (BTO:0001300) | PubMed (16508179) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oriciacridone F (CHEBI:66836) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| oriciacridone F (CHEBI:66836) has role metabolite (CHEBI:25212) |
| oriciacridone F (CHEBI:66836) has role radical scavenger (CHEBI:48578) |
| oriciacridone F (CHEBI:66836) is a acridone derivatives (CHEBI:61878) |
| oriciacridone F (CHEBI:66836) is a alkaloid (CHEBI:22315) |
| oriciacridone F (CHEBI:66836) is a cyclic ether (CHEBI:37407) |
| oriciacridone F (CHEBI:66836) is a organic heterotetracyclic compound (CHEBI:38163) |
| oriciacridone F (CHEBI:66836) is a polyphenol (CHEBI:26195) |
| oriciacridone F (CHEBI:66836) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 6,6',11,11'-tetrahydroxy-3,3,3',3'-tetramethyl-1,1',2,2',3,3',12,12'-octahydro-7H,7'H-1,5'-bipyrano[2,3-c]acridine-7,7'-dione |
| Synonyms | Source |
|---|---|
| 5-(6,11-dihydroxy-3,3-dimethyl-7-oxo-2,12-dihydro-1H-pyrano[2,3-c]acridin-1-yl)-6,11-dihydroxy-3,3-dimethyl-2,12-dihydro-1H-pyrano[2,3-c]acridin-7-one | ChEBI |
| (+)-bis-5-hydroxy-(10H)-hydronoracromycine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10412578 | Reaxys |
| Citations |
|---|