EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H32N2O8 |
| Net Charge | 0 |
| Average Mass | 620.658 |
| Monoisotopic Mass | 620.21587 |
| SMILES | CC1(C)CC(c2c3c(c4nc5c(O)cccc5c(=O)c4c2O)CCC(C)(C)O3)c2c(cc(O)c3c(=O)c4cccc(O)c4nc23)O1 |
| InChI | InChI=1S/C36H32N2O8/c1-35(2)12-11-17-29-26(32(43)16-8-6-9-19(39)27(16)37-29)33(44)24(34(17)46-35)18-14-36(3,4)45-22-13-21(41)25-30(23(18)22)38-28-15(31(25)42)7-5-10-20(28)40/h5-10,13,18,39-41,44H,11-12,14H2,1-4H3,(H,37,43)(H,38,42) |
| InChIKey | YPOUKZJOAMKOEN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oriciopsis glaberrima (IPNI:774491-1) | stem (BTO:0001300) | PubMed (16508179) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oriciacridone F (CHEBI:66836) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| oriciacridone F (CHEBI:66836) has role metabolite (CHEBI:25212) |
| oriciacridone F (CHEBI:66836) has role radical scavenger (CHEBI:48578) |
| oriciacridone F (CHEBI:66836) is a acridone derivatives (CHEBI:61878) |
| oriciacridone F (CHEBI:66836) is a alkaloid (CHEBI:22315) |
| oriciacridone F (CHEBI:66836) is a cyclic ether (CHEBI:37407) |
| oriciacridone F (CHEBI:66836) is a organic heterotetracyclic compound (CHEBI:38163) |
| oriciacridone F (CHEBI:66836) is a polyphenol (CHEBI:26195) |
| oriciacridone F (CHEBI:66836) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 6,6',11,11'-tetrahydroxy-3,3,3',3'-tetramethyl-1,1',2,2',3,3',12,12'-octahydro-7H,7'H-1,5'-bipyrano[2,3-c]acridine-7,7'-dione |
| Synonyms | Source |
|---|---|
| 5-(6,11-dihydroxy-3,3-dimethyl-7-oxo-2,12-dihydro-1H-pyrano[2,3-c]acridin-1-yl)-6,11-dihydroxy-3,3-dimethyl-2,12-dihydro-1H-pyrano[2,3-c]acridin-7-one | ChEBI |
| (+)-bis-5-hydroxy-(10H)-hydronoracromycine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10412578 | Reaxys |
| Citations |
|---|