EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O9 |
| Net Charge | 0 |
| Average Mass | 516.587 |
| Monoisotopic Mass | 516.23593 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C28H36O9/c1-15-13-21(33-16(2)29)24(35-18(4)31)27(7)22(36-25(32)19-11-9-8-10-12-19)14-20-23(34-17(3)30)28(15,27)37-26(20,5)6/h8-12,15,20-24H,13-14H2,1-7H3/t15-,20-,21+,22+,23-,24+,27-,28-/m1/s1 |
| InChIKey | BGJHHQRHKDDKIR-OKPVOZINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (10346948) | |
| Celastrus stephanotiifolius (IPNI:160523-1) | seed (BTO:0001226) | PubMed (8350085) | |
| Tripterygium wilfordii regelii (IPNI:162907-1) | - | DOI (10.1016/0031-9422(90)85349-K) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Triptogelin C-1 (CHEBI:66834) has role metabolite (CHEBI:25212) |
| Triptogelin C-1 (CHEBI:66834) is a sesquiterpenoid (CHEBI:26658) |
| Synonyms | Source |
|---|---|
| 1beta,2-beta,6alpha-triacetoxy-9alpha-benzoyloxy-dihydro-beta-agarofuran | ChEBI |
| (1S,2R,4S,5R,6R,7S,9R,12R)-4,5,12-Triacetoxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-7-yl benzoate | ChEBI |
| Citations |
|---|