EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38O7 |
| Net Charge | 0 |
| Average Mass | 546.660 |
| Monoisotopic Mass | 546.26175 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(C)[C@@H](OC(C)=O)CC[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H38O7/c1-21-16-18-26(37-22(2)34)32(5)27(38-30(36)24-14-10-7-11-15-24)20-25-29(33(21,32)40-31(25,3)4)39-28(35)19-17-23-12-8-6-9-13-23/h6-15,17,19,21,25-27,29H,16,18,20H2,1-5H3/b19-17+/t21-,25-,26+,27+,29-,32+,33-/m1/s1 |
| InChIKey | HYPWFAUBYBMXNJ-DMRFDBRWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (9461657) | |
| Celastrus stephanotiifolius (IPNI:160523-1) | seed (BTO:0001226) | PubMed (8350085) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Celafolin A-1 (CHEBI:66831) has role metabolite (CHEBI:25212) |
| Celafolin A-1 (CHEBI:66831) is a sesquiterpenoid (CHEBI:26658) |
| Synonyms | Source |
|---|---|
| 1beta-acetoxy-9alpha-benzoyloxy-6alpha-cinnamoyloxy-dihydro-beta-agarofuran | ChEBI |
| (1S,2R,5S,6S,7S,9R,12R)-5-Acetoxy-2,6,10,10-tetramethyl-12-{[(2E)-3-phenyl-2-propenoyl]oxy}-11-oxatricyclo[7.2.1.0[1,6]]dodec-7-yl benzoate | ChEBI |
| Citations |
|---|