EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H36O11 |
| Net Charge | 0 |
| Average Mass | 620.651 |
| Monoisotopic Mass | 620.22576 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(C)[C@@H](OC(C)=O)[C@@H](OC(=O)c4ccoc4)C[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(=O)c1ccoc1 |
| InChI | InChI=1S/C34H36O11/c1-19-15-25(42-30(37)22-11-13-39-17-22)28(41-20(2)35)33(5)26(43-29(36)21-9-7-6-8-10-21)16-24-27(34(19,33)45-32(24,3)4)44-31(38)23-12-14-40-18-23/h6-14,17-19,24-28H,15-16H2,1-5H3/t19-,24-,25+,26+,27-,28+,33-,34-/m1/s1 |
| InChIKey | BRLFNCXCWAFVFC-DYQOWCLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (10346948) |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orbiculin F (CHEBI:66827) has functional parent 3-furoic acid (CHEBI:30846) |
| orbiculin F (CHEBI:66827) has role antineoplastic agent (CHEBI:35610) |
| orbiculin F (CHEBI:66827) has role metabolite (CHEBI:25212) |
| orbiculin F (CHEBI:66827) has role NF-κB inhibitor (CHEBI:73240) |
| orbiculin F (CHEBI:66827) is a acetate ester (CHEBI:47622) |
| orbiculin F (CHEBI:66827) is a benzoate ester (CHEBI:36054) |
| orbiculin F (CHEBI:66827) is a bridged compound (CHEBI:35990) |
| orbiculin F (CHEBI:66827) is a cyclic ether (CHEBI:37407) |
| orbiculin F (CHEBI:66827) is a dihydroagarofuran sesquiterpenoid (CHEBI:71548) |
| orbiculin F (CHEBI:66827) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3R,5S,5aR,6R,7S,9R,9aS,10R)-6-(acetyloxy)-5-(benzoyloxy)-2,2,5a,9-tetramethyloctahydro-2H-3,9a-methano-1-benzoxepine-7,10-diyl difuran-3-carboxylate |
| Synonyms | Source |
|---|---|
| (1S,2R,4S,5R,6R,7S,9R,12R)-5-acetoxy-7-(benzoyloxy)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecane-4,12-diyl di(3-furoate) | IUPAC |
| 1β-acetoxy-9α-benzoyloxy-2β,6α-di(3-furoyloxy)-dihydro-β-agarofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8374098 | Reaxys |
| Citations |
|---|