EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36O10 |
| Net Charge | 0 |
| Average Mass | 568.619 |
| Monoisotopic Mass | 568.23085 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(=O)c1ccoc1 |
| InChI | InChI=1S/C31H36O10/c1-17-14-23(37-18(2)32)26(38-19(3)33)30(6)24(39-27(34)20-10-8-7-9-11-20)15-22-25(31(17,30)41-29(22,4)5)40-28(35)21-12-13-36-16-21/h7-13,16-17,22-26H,14-15H2,1-6H3/t17-,22-,23+,24+,25-,26+,30-,31-/m1/s1 |
| InChIKey | GAOKKLOHOKIMQT-KBAKPPLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (10346948) |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orbiculin E (CHEBI:66826) has functional parent 3-furoic acid (CHEBI:30846) |
| orbiculin E (CHEBI:66826) has role antineoplastic agent (CHEBI:35610) |
| orbiculin E (CHEBI:66826) has role metabolite (CHEBI:25212) |
| orbiculin E (CHEBI:66826) has role NF-κB inhibitor (CHEBI:73240) |
| orbiculin E (CHEBI:66826) is a acetate ester (CHEBI:47622) |
| orbiculin E (CHEBI:66826) is a benzoate ester (CHEBI:36054) |
| orbiculin E (CHEBI:66826) is a bridged compound (CHEBI:35990) |
| orbiculin E (CHEBI:66826) is a cyclic ether (CHEBI:37407) |
| orbiculin E (CHEBI:66826) is a dihydroagarofuran sesquiterpenoid (CHEBI:71548) |
| orbiculin E (CHEBI:66826) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3R,5S,5aR,6R,7S,9R,9aS,10R)-6,7-bis(acetyloxy)-5-(benzoyloxy)-2,2,5a,9-tetramethyloctahydro-2H-3,9a-methano-1-benzoxepin-10-yl furan-3-carboxylate |
| Synonyms | Source |
|---|---|
| (1S,2R,4S,5R,6R,7S,9R,12R)-4,5-diacetoxy-7-(benzoyloxy)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-12-yl 3-furoate | IUPAC |
| 1β,2β-diacetoxy-9α-benzoyloxy-6α-(3-furoyloxy)-dihydro-β-agarofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8370943 | Reaxys |
| Citations |
|---|