EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38O9 |
| Net Charge | 0 |
| Average Mass | 578.658 |
| Monoisotopic Mass | 578.25158 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H38O9/c1-19-17-25(38-20(2)34)28(39-21(3)35)32(6)26(40-29(36)22-13-9-7-10-14-22)18-24-27(33(19,32)42-31(24,4)5)41-30(37)23-15-11-8-12-16-23/h7-16,19,24-28H,17-18H2,1-6H3/t19-,24-,25+,26+,27-,28+,32-,33-/m1/s1 |
| InChIKey | KYEKMLQQOXNBSD-HJJCBLRASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (9461657) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orbiculin A (CHEBI:66824) has role antineoplastic agent (CHEBI:35610) |
| orbiculin A (CHEBI:66824) has role metabolite (CHEBI:25212) |
| orbiculin A (CHEBI:66824) has role NF-κB inhibitor (CHEBI:73240) |
| orbiculin A (CHEBI:66824) is a acetate ester (CHEBI:47622) |
| orbiculin A (CHEBI:66824) is a benzoate ester (CHEBI:36054) |
| orbiculin A (CHEBI:66824) is a bridged compound (CHEBI:35990) |
| orbiculin A (CHEBI:66824) is a cyclic ether (CHEBI:37407) |
| orbiculin A (CHEBI:66824) is a dihydroagarofuran sesquiterpenoid (CHEBI:71548) |
| orbiculin A (CHEBI:66824) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3R,5S,5aR,6R,7S,9R,9aS,10R)-6,7-bis(acetyloxy)-2,2,5a,9-tetramethyloctahydro-2H-3,9a-methano-1-benzoxepine-5,10-diyl dibenzoate |
| Synonyms | Source |
|---|---|
| (1S,2R,4S,5R,6R,7S,9R,12R)-4,5-diacetoxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecane-7,12-diyl dibenzoate | IUPAC |
| 1β,2β-diacetoxy-6α,9α-bis(benzoyloxy)dihydro-β-agarofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7959601 | Reaxys |
| Citations |
|---|