EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H54O5 |
| Net Charge | 0 |
| Average Mass | 578.834 |
| Monoisotopic Mass | 578.39712 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C)C1=C(O)C(=O)c2c(ccc3c2CCCC3(C)C)C1=O |
| InChI | InChI=1S/C37H54O5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-31(38)42-26-27(2)32-34(39)29-23-24-30-28(21-20-25-37(30,3)4)33(29)36(41)35(32)40/h12-13,23-24,27,40H,5-11,14-22,25-26H2,1-4H3/b13-12- |
| InChIKey | ZDZOJQPZBICBMD-SEYXRHQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia miltiorrhiza (ncbitaxon:226208) | root (BTO:0001188) | PubMed (11374966) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleoyl neocryptotanshinone (CHEBI:66820) has functional parent oleic acid (CHEBI:16196) |
| oleoyl neocryptotanshinone (CHEBI:66820) has role metabolite (CHEBI:25212) |
| oleoyl neocryptotanshinone (CHEBI:66820) has role platelet aggregation inhibitor (CHEBI:50427) |
| oleoyl neocryptotanshinone (CHEBI:66820) is a p-quinones (CHEBI:25830) |
| oleoyl neocryptotanshinone (CHEBI:66820) is a carbotricyclic compound (CHEBI:38032) |
| oleoyl neocryptotanshinone (CHEBI:66820) is a diterpenoid (CHEBI:23849) |
| oleoyl neocryptotanshinone (CHEBI:66820) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| 2-(3-hydroxy-8,8-dimethyl-1,4-dioxo-1,4,5,6,7,8-hexahydrophenanthren-2-yl)propyl (9Z)-octadec-9-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8887958 | Reaxys |
| Citations |
|---|