EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H48O5 |
| Net Charge | 0 |
| Average Mass | 560.775 |
| Monoisotopic Mass | 560.35017 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C)C1=C(O)C(=O)c2c(ccc3c(C)cccc23)C1=O |
| InChI | InChI=1S/C36H48O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-31(37)41-25-27(3)32-34(38)30-24-23-28-26(2)20-19-21-29(28)33(30)36(40)35(32)39/h11-12,19-21,23-24,27,39H,4-10,13-18,22,25H2,1-3H3/b12-11- |
| InChIKey | CKCNLHQWTDJDRS-QXMHVHEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia miltiorrhiza (ncbitaxon:226208) | root (BTO:0001188) | PubMed (11374966) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleoyl danshenxinkun A (CHEBI:66819) has functional parent oleic acid (CHEBI:16196) |
| oleoyl danshenxinkun A (CHEBI:66819) has role metabolite (CHEBI:25212) |
| oleoyl danshenxinkun A (CHEBI:66819) has role platelet aggregation inhibitor (CHEBI:50427) |
| oleoyl danshenxinkun A (CHEBI:66819) is a p-quinones (CHEBI:25830) |
| oleoyl danshenxinkun A (CHEBI:66819) is a diterpenoid (CHEBI:23849) |
| oleoyl danshenxinkun A (CHEBI:66819) is a fatty acid ester (CHEBI:35748) |
| oleoyl danshenxinkun A (CHEBI:66819) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 2-(3-hydroxy-8-methyl-1,4-dioxo-1,4-dihydrophenanthren-2-yl)propyl (9Z)-octadec-9-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8886925 | Reaxys |
| Citations |
|---|