EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O6 |
| Net Charge | 0 |
| Average Mass | 434.488 |
| Monoisotopic Mass | 434.17294 |
| SMILES | CC[C@H](C)C(=O)c1c(O)c2c(-c3ccccc3)cc(=O)oc2c2cc(C(C)(C)OC)oc12 |
| InChI | InChI=1S/C26H26O6/c1-6-14(2)22(28)21-23(29)20-16(15-10-8-7-9-11-15)13-19(27)32-24(20)17-12-18(31-25(17)21)26(3,4)30-5/h7-14,29H,6H2,1-5H3/t14-/m0/s1 |
| InChIKey | PSBCHGQXBPONOM-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ochrocarpos punctatus (IPNI:428950-1) | bark (BTO:0001301) | PubMed (12141854) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochrocarpin D (CHEBI:66814) has role antineoplastic agent (CHEBI:35610) |
| ochrocarpin D (CHEBI:66814) has role metabolite (CHEBI:25212) |
| ochrocarpin D (CHEBI:66814) is a furanocoumarin (CHEBI:24128) |
| ochrocarpin D (CHEBI:66814) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-hydroxy-8-(2-methoxypropan-2-yl)-6-[(2S)-2-methylbutanoyl]-4-phenyl-2H-furo[2,3-h]chromen-2-one |
| Synonym | Source |
|---|---|
| 5-hydroxy-8-(1-methoxy-1-methylethyl)-6-(2-methyl-1-oxobutyl)-4-phenyl-2H-furo-[2',3':5,6]benzo[1,2-b]pyran-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9304582 | Reaxys |
| Citations |
|---|