EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H42O5 |
| Net Charge | 0 |
| Average Mass | 518.694 |
| Monoisotopic Mass | 518.30322 |
| SMILES | CC(C)=CCC1CC2(CC=C(C)C)C(=O)C(C(=O)c3ccccc3)(C(=O)C3=C2OC(C(C)(C)O)C3)C1(C)C |
| InChI | InChI=1S/C33H42O5/c1-20(2)14-15-23-19-32(17-16-21(3)4)28-24(18-25(38-28)31(7,8)37)27(35)33(29(32)36,30(23,5)6)26(34)22-12-10-9-11-13-22/h9-14,16,23,25,37H,15,17-19H2,1-8H3 |
| InChIKey | PHBDYBJOGVFIQU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ochrocarpos punctatus (IPNI:428950-1) | bark (BTO:0001301) | PubMed (12141854) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochrocarpinone C (CHEBI:66810) has role metabolite (CHEBI:25212) |
| ochrocarpinone C (CHEBI:66810) is a aromatic ketone (CHEBI:76224) |
| ochrocarpinone C (CHEBI:66810) is a bridged compound (CHEBI:35990) |
| ochrocarpinone C (CHEBI:66810) is a cyclic ether (CHEBI:37407) |
| ochrocarpinone C (CHEBI:66810) is a cyclic ketone (CHEBI:3992) |
| ochrocarpinone C (CHEBI:66810) is a enone (CHEBI:51689) |
| ochrocarpinone C (CHEBI:66810) is a organic heterotricyclic compound (CHEBI:26979) |
| ochrocarpinone C (CHEBI:66810) is a tertiary alcohol (CHEBI:26878) |
| ochrocarpinone C (CHEBI:66810) is a β-diketone (CHEBI:67265) |
| ochrocarpinone C (CHEBI:66810) is a β-triketone (CHEBI:140323) |
| IUPAC Name |
|---|
| 5-benzoyl-2-(2-hydroxypropan-2-yl)-6,6-dimethyl-7,9-bis(3-methylbut-2-en-1-yl)-3,5,6,7,8,9-hexahydro-5,9-methanocycloocta[b]furan-4,10(2H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9307470 | Reaxys |
| Citations |
|---|