EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O6 |
| Net Charge | 0 |
| Average Mass | 340.331 |
| Monoisotopic Mass | 340.09469 |
| SMILES | CC1CC(=O)C2(O)C3=C(C=CC2(O)C1)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C19H16O6/c1-9-7-13(21)19(25)15-11(5-6-18(19,24)8-9)16(22)14-10(17(15)23)3-2-4-12(14)20/h2-6,9,20,24-25H,7-8H2,1H3 |
| InChIKey | HRKDTQUJICJRIH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amycolatopsis sp. (ncbitaxon:37632) | - | PubMed (7775274) | Strain: MJ 950-89F4 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochracenomicin A (CHEBI:66807) has role antibacterial agent (CHEBI:33282) |
| ochracenomicin A (CHEBI:66807) is a p-quinones (CHEBI:25830) |
| ochracenomicin A (CHEBI:66807) is a angucycline antibiotic (CHEBI:70737) |
| ochracenomicin A (CHEBI:66807) is a phenols (CHEBI:33853) |
| ochracenomicin A (CHEBI:66807) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 4a,8,12b-trihydroxy-3-methyl-3,4,4a,12b-tetrahydrotetraphene-1,7,12(2H)-trione |
| Synonym | Source |
|---|---|
| 4a,8,12b-trihydroxy-3-methyl-3,4-dihydro-2H-benzo[a]anthracene-1,7,12-trione | ChEBI |
| Citations |
|---|