EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H41N5O6S |
| Net Charge | 0 |
| Average Mass | 599.754 |
| Monoisotopic Mass | 599.27776 |
| SMILES | CC[C@H]1CC(=O)O[C@@H](C)C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)c2nc(cs2)C(=O)N1 |
| InChI | InChI=1S/C30H41N5O6S/c1-8-21-15-24(36)41-19(5)29(39)35(7)25(17(2)3)30(40)34(6)23(14-20-12-10-9-11-13-20)27(38)31-18(4)28-33-22(16-42-28)26(37)32-21/h9-13,16-19,21,23,25H,8,14-15H2,1-7H3,(H,31,38)(H,32,37)/t18-,19-,21-,23-,25-/m0/s1 |
| InChIKey | HTERYHQTEBIQTA-USLAZGEGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya confervoides (ncbitaxon:207921) | - | PubMed (11809060) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obyanamide (CHEBI:66805) has role antineoplastic agent (CHEBI:35610) |
| obyanamide (CHEBI:66805) has role metabolite (CHEBI:25212) |
| obyanamide (CHEBI:66805) is a cyclodepsipeptide (CHEBI:35213) |
| obyanamide (CHEBI:66805) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (2S,5S,8S,11S,15S)-5-benzyl-15-ethyl-2,6,9,11-tetramethyl-8-(propan-2-yl)-12-oxa-20-thia-3,6,9,16,21-pentaazabicyclo[16.2.1]henicosa-1(21),18-diene-4,7,10,13,17-pentone |
| Synonym | Source |
|---|---|
| (4S,8S,11S,14S,17S)-14-benzyl-4-ethyl-8,10,13,17-tetramethyl-11-propan-2-yl-7-oxa-19-thia-3,10,13,16,21-pentazabicyclo[16.2.1]henicosa-1(20),18(21)-diene-2,6,9,12,15-pentone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9101921 | Reaxys |
| Citations |
|---|