EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O4 |
| Net Charge | 0 |
| Average Mass | 310.349 |
| Monoisotopic Mass | 310.12051 |
| SMILES | [H][C@@]1(C[C@H]2CC=CC(=O)O2)CC(=O)C=C(/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C19H18O4/c20-15-11-17(10-9-14-5-2-1-3-6-14)22-18(12-15)13-16-7-4-8-19(21)23-16/h1-6,8-11,16,18H,7,12-13H2/b10-9+/t16-,18+/m1/s1 |
| InChIKey | NZGGCMIUTMKVIG-WADNSWHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptocarya obovata (ncbitaxon:29743) | |||
| trunk bark (BTO:0001494) | PubMed (15165150) | ||
| fruit (BTO:0000486) | PubMed (15165150) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obolactone (CHEBI:66803) has role antineoplastic agent (CHEBI:35610) |
| obolactone (CHEBI:66803) has role plant metabolite (CHEBI:76924) |
| obolactone (CHEBI:66803) is a 2-pyranones (CHEBI:75885) |
| obolactone (CHEBI:66803) is a 4-pyranones (CHEBI:131906) |
| IUPAC Name |
|---|
| (6R)-6-({(2R)-4-oxo-6-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyran-2-yl}methyl)-5,6-dihydro-2H-pyran-2-one |
| Synonym | Source |
|---|---|
| (2R)-2-[[(2R)-6-oxo-2,3-dihydropyran-2-yl]methyl]-6-[(E)-2-phenylethenyl]-2,3-dihydropyran-4-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10689895 | Reaxys |
| Citations |
|---|