EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H58O10 |
| Net Charge | 0 |
| Average Mass | 674.872 |
| Monoisotopic Mass | 674.40300 |
| SMILES | [H][C@]12C3=CC[C@]4([H])[C@@]5(C)CC[C@]6([H])O[C@H](CO)OC[C@@]6(C)[C@]5([H])CC[C@@]4(C)[C@]3(C)CC[C@@]1(C(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CCC(C)=C2C |
| InChI | InChI=1S/C38H58O10/c1-20-9-14-38(33(44)48-32-31(43)30(42)29(41)23(17-39)46-32)16-15-36(5)22(28(38)21(20)2)7-8-25-34(3)12-11-26-35(4,19-45-27(18-40)47-26)24(34)10-13-37(25,36)6/h7,23-32,39-43H,8-19H2,1-6H3/t23-,24-,25-,26+,27-,28+,29-,30+,31-,32+,34+,35+,36-,37-,38+/m1/s1 |
| InChIKey | XNXBBAVPDDPLJE-IUFVKNBISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ilex oblonga (IPNI:897999-1) | leaf (BTO:0000713) | PubMed (17329884) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oblonganoside A (CHEBI:66801) has role antiviral agent (CHEBI:22587) |
| oblonganoside A (CHEBI:66801) has role plant metabolite (CHEBI:76924) |
| oblonganoside A (CHEBI:66801) is a carboxylic ester (CHEBI:33308) |
| oblonganoside A (CHEBI:66801) is a hexacyclic triterpenoid (CHEBI:70994) |
| oblonganoside A (CHEBI:66801) is a monosaccharide derivative (CHEBI:63367) |
| oblonganoside A (CHEBI:66801) is a oxacycle (CHEBI:38104) |
| oblonganoside A (CHEBI:66801) is a triterpenoid saponin (CHEBI:61778) |
| oblonganoside A (CHEBI:66801) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-{[(2R,4aR,4bR,6aR,6bS,8aS,12aS,14aR,14bR,16aS)-2-(hydroxymethyl)-4a,6a,6b,11,12,14b-hexamethyl-4a,5,6,6a,6b,7,8,9,10,12a,14,14a,14b,15,16,16a-hexadecahydro-4H-piceno[3,4-d][1,3]dioxin-8a(4bH)-yl]carbonyl}-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 3,23-O-hydroxyethylidene-3β,23-dihydroxyurs-12,19(20)-dien-28-oic acid 28-β-D-glucopyranosyl ester | ChEBI |
| Citations |
|---|