EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H58O10 |
| Net Charge | 0 |
| Average Mass | 674.872 |
| Monoisotopic Mass | 674.40300 |
| SMILES | [H][C@]12C3=CC[C@]4([H])[C@@]5(C)CC[C@]6([H])O[C@H](CO)OC[C@@]6(C)[C@]5([H])CC[C@@]4(C)[C@]3(C)CC[C@@]1(C(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CCC(C)=C2C |
| InChI | InChI=1S/C38H58O10/c1-20-9-14-38(33(44)48-32-31(43)30(42)29(41)23(17-39)46-32)16-15-36(5)22(28(38)21(20)2)7-8-25-34(3)12-11-26-35(4,19-45-27(18-40)47-26)24(34)10-13-37(25,36)6/h7,23-32,39-43H,8-19H2,1-6H3/t23-,24-,25-,26+,27-,28+,29-,30+,31-,32+,34+,35+,36-,37-,38+/m1/s1 |
| InChIKey | XNXBBAVPDDPLJE-IUFVKNBISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ilex oblonga (IPNI:897999-1) | leaf (BTO:0000713) | PubMed (17329884) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oblonganoside A (CHEBI:66801) has role antiviral agent (CHEBI:22587) |
| oblonganoside A (CHEBI:66801) has role plant metabolite (CHEBI:76924) |
| oblonganoside A (CHEBI:66801) is a carboxylic ester (CHEBI:33308) |
| oblonganoside A (CHEBI:66801) is a hexacyclic triterpenoid (CHEBI:70994) |
| oblonganoside A (CHEBI:66801) is a monosaccharide derivative (CHEBI:63367) |
| oblonganoside A (CHEBI:66801) is a oxacycle (CHEBI:38104) |
| oblonganoside A (CHEBI:66801) is a triterpenoid saponin (CHEBI:61778) |
| oblonganoside A (CHEBI:66801) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-{[(2R,4aR,4bR,6aR,6bS,8aS,12aS,14aR,14bR,16aS)-2-(hydroxymethyl)-4a,6a,6b,11,12,14b-hexamethyl-4a,5,6,6a,6b,7,8,9,10,12a,14,14a,14b,15,16,16a-hexadecahydro-4H-piceno[3,4-d][1,3]dioxin-8a(4bH)-yl]carbonyl}-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 3,23-O-hydroxyethylidene-3β,23-dihydroxyurs-12,19(20)-dien-28-oic acid 28-β-D-glucopyranosyl ester | ChEBI |
| Citations |
|---|