EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO7 |
| Net Charge | 0 |
| Average Mass | 373.361 |
| Monoisotopic Mass | 373.11615 |
| SMILES | O=C1CCC(c2c(O)cc3c(c2O)C[C@@H](O)[C@@H](c2ccc(O)c(O)c2)O3)N1 |
| InChI | InChI=1S/C19H19NO7/c21-11-3-1-8(5-12(11)22)19-14(24)6-9-15(27-19)7-13(23)17(18(9)26)10-2-4-16(25)20-10/h1,3,5,7,10,14,19,21-24,26H,2,4,6H2,(H,20,25)/t10?,14-,19-/m1/s1 |
| InChIKey | UCIRBQYYKCLWFF-SEKYPHQKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinidia arguta (ncbitaxon:64478) | root (BTO:0001188) | PubMed (19336935) | 5:3 diastereomeric mixture |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(2-Pyrrolidinone-5-yl)-(-)-epicatechin (CHEBI:66799) has role metabolite (CHEBI:25212) |
| 6-(2-Pyrrolidinone-5-yl)-(-)-epicatechin (CHEBI:66799) is a catechin (CHEBI:23053) |
| Citations |
|---|