EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O6 |
| Net Charge | 0 |
| Average Mass | 394.423 |
| Monoisotopic Mass | 394.14164 |
| SMILES | CC(C)=CCc1c2c(c(O)c3c(=O)c4cc(O)c(O)cc4oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H22O6/c1-11(2)5-6-13-21-12(7-8-23(3,4)29-21)19(26)18-20(27)14-9-15(24)16(25)10-17(14)28-22(13)18/h5,7-10,24-26H,6H2,1-4H3 |
| InChIKey | PIGUNUPUFZDCAM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia lancilimba (IPNI:897794-1) | bark (BTO:0001301) | PubMed (17541202) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,6,7-trihydroxy-6',6'-dimethyl-2H-pyrano(2',3':3,2)-4-(3-methylbut-2-enyl)xanthone (CHEBI:66793) has role antineoplastic agent (CHEBI:35610) |
| 1,6,7-trihydroxy-6',6'-dimethyl-2H-pyrano(2',3':3,2)-4-(3-methylbut-2-enyl)xanthone (CHEBI:66793) has role metabolite (CHEBI:25212) |
| 1,6,7-trihydroxy-6',6'-dimethyl-2H-pyrano(2',3':3,2)-4-(3-methylbut-2-enyl)xanthone (CHEBI:66793) is a polyphenol (CHEBI:26195) |
| 1,6,7-trihydroxy-6',6'-dimethyl-2H-pyrano(2',3':3,2)-4-(3-methylbut-2-enyl)xanthone (CHEBI:66793) is a pyranoxanthones (CHEBI:71238) |
| IUPAC Name |
|---|
| 5,8,9-trihydroxy-2,2-dimethyl-12-(3-methylbut-2-en-1-yl)-2H,6H-pyrano[3,2-b]xanthen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11192821 | Reaxys |
| Citations |
|---|