EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N4O3 |
| Net Charge | 0 |
| Average Mass | 370.453 |
| Monoisotopic Mass | 370.20049 |
| SMILES | [H][C@]12CC(=O)[C@H](Cn3c(O)nc4c(O)ncnc43)[C@]13CC(C)(C)[C@@]2([H])CC[C@@H]3C |
| InChI | InChI=1S/C20H26N4O3/c1-10-4-5-11-12-6-14(25)13(20(10,12)8-19(11,2)3)7-24-16-15(23-18(24)27)17(26)22-9-21-16/h9-13H,4-8H2,1-3H3,(H,23,27)(H,21,22,26)/t10-,11-,12+,13-,20-/m0/s1 |
| InChIKey | BHCRQXWMNOFEEK-OWPPUKJFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Subergorgia suberosa (ncbitaxon:767284) | - | PubMed (16124781) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(9'-Purine-6',8'-diolyl)-2beta-suberosanone (CHEBI:66791) has role metabolite (CHEBI:25212) |
| 6-(9'-Purine-6',8'-diolyl)-2beta-suberosanone (CHEBI:66791) is a oxopurine (CHEBI:25810) |
| Synonyms | Source |
|---|---|
| (3S,3aS,4S,7S,7aR)-3-[(6,8-dihydroxy-9H-purin-9-yl)methyl]-4,8,8-trimethylhexahydro-3a,7-ethanoinden-2(3H)-one | ChEBI |
| 9-{[(1S,2S,5R,6S,9S)-9,11,11-Trimethyl-3-oxotricyclo[4.3.2.01,5]undec-2-yl]methyl}-7,9-dihydro-3H-purine-6,8-dione | ChEBI |
| Citations |
|---|