EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | CC1=CC(=O)N/C1=C\C(C)C |
| InChI | InChI=1S/C9H13NO/c1-6(2)4-8-7(3)5-9(11)10-8/h4-6H,1-3H3,(H,10,11)/b8-4- |
| InChIKey | NZFGXTZLJPSCGW-YWEYNIOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corollospora pulchella (ncbitaxon:201938) | - | PubMed (9666182) | Strain: ATCC 62554 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pulchellalactum (CHEBI:66789) has role metabolite (CHEBI:25212) |
| Pulchellalactum (CHEBI:66789) is a pyrroline (CHEBI:23763) |
| Synonym | Source |
|---|---|
| (5Z)-4-methyl-5-(2-methylpropylidene)pyrrol-2-one | ChEBI |
| Citations |
|---|