EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NO |
| Net Charge | 0 |
| Average Mass | 311.469 |
| Monoisotopic Mass | 311.22491 |
| SMILES | [H][C@]1([C@@H](C)CCC=C(C)C)CC[C@@H](C)c2c1cc(C)c1ncoc21 |
| InChI | InChI=1S/C21H29NO/c1-13(2)7-6-8-14(3)17-10-9-15(4)19-18(17)11-16(5)20-21(19)23-12-22-20/h7,11-12,14-15,17H,6,8-10H2,1-5H3/t14-,15+,17+/m0/s1 |
| InChIKey | HXPRVILAXUEVFC-ZMSDIMECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudopterogorgia elisabethae (ncbitaxon:204377) | - | PubMed (10822593) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seco-Pseudopteroxazole (CHEBI:66787) has role metabolite (CHEBI:25212) |
| seco-Pseudopteroxazole (CHEBI:66787) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (6R,9R)-4,9-Dimethyl-6-[(2S)-6-methyl-5-hepten-2-yl]-6,7,8,9-tetrahydronaphtho[2,1-d][1,3]oxazole | ChEBI |
| Citations |
|---|