EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H52O9 |
| Net Charge | 0 |
| Average Mass | 616.792 |
| Monoisotopic Mass | 616.36113 |
| SMILES | [H][C@@]1([C@]2([H])C[C@]([H])([C@@H](O)C(C)(C)O)O[C@H]2OC)CC=C2[C@@]1(C)C[C@@H](OC(C)=O)[C@]1([H])[C@@]3(C)C=CC(=O)C(C)(C)[C@]3([H])C[C@@H](OC(C)=O)[C@@]21C |
| InChI | InChI=1S/C35H52O9/c1-18(36)42-23-17-34(8)21(20-15-22(44-30(20)41-10)29(39)32(5,6)40)11-12-24(34)35(9)27(43-19(2)37)16-25-31(3,4)26(38)13-14-33(25,7)28(23)35/h12-14,20-23,25,27-30,39-40H,11,15-17H2,1-10H3/t20-,21-,22+,23+,25-,27+,28+,29+,30+,33-,34-,35+/m0/s1 |
| InChIKey | VLHOBEFYZZUNTQ-CHMNAIGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylocarpus granatum (ncbitaxon:241841) | rind (BTO:0001184) | DOI (10.1002/hlca.200800177) | Dried fruit rinds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Protoxylocarpin E (CHEBI:66784) has role metabolite (CHEBI:25212) |
| Protoxylocarpin E (CHEBI:66784) is a limonoid (CHEBI:39434) |