EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O6 |
| Net Charge | 0 |
| Average Mass | 516.719 |
| Monoisotopic Mass | 516.34509 |
| SMILES | [H][C@@]1([C@]2([H])C[C@]([H])([C@@H](O)C(C)(C)O)O[C@@H]2OC)CC=C2[C@@]1(C)CC[C@]1([H])[C@@]3(C)C=CC(=O)C(C)(C)[C@]3([H])C[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C31H48O6/c1-27(2)22-16-24(33)31(7)20-10-9-18(17-15-19(37-26(17)36-8)25(34)28(3,4)35)29(20,5)13-11-21(31)30(22,6)14-12-23(27)32/h10,12,14,17-19,21-22,24-26,33-35H,9,11,13,15-16H2,1-8H3/t17-,18-,19+,21+,22-,24+,25+,26-,29-,30+,31-/m0/s1 |
| InChIKey | XCCPYESNSWQOFT-REAAIDBESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylocarpus granatum (ncbitaxon:241841) | rind (BTO:0001184) | DOI (10.1002/hlca.200800177) | Dried fruit rinds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Protoxylocarpin D (CHEBI:66783) has role metabolite (CHEBI:25212) |
| Protoxylocarpin D (CHEBI:66783) is a limonoid (CHEBI:39434) |
| Synonym | Source |
|---|---|
| (5R,7R,8R,9R,10R,13S,17S)-17-((2S,3S,5R)-5-((1R)-1,2-dihydroxy-2-methylpropyl)-2-methoxytetrahydrofuran-3-yl)-7-hydroxy-4,4,8,10,13-pentamethyl-4,5,6,7,8,9,10,11,12,13,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-one | ChEBI |