EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O6 |
| Net Charge | 0 |
| Average Mass | 530.746 |
| Monoisotopic Mass | 530.36074 |
| SMILES | [H][C@@]1([C@]2([H])C[C@]([H])([C@@H](O)C(C)(C)O)O[C@@H]2OCC)CC=C2[C@@]1(C)CC[C@]1([H])[C@@]3(C)C=CC(=O)C(C)(C)[C@]3([H])C[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C32H50O6/c1-9-37-27-18(16-20(38-27)26(35)29(4,5)36)19-10-11-21-30(19,6)14-12-22-31(7)15-13-24(33)28(2,3)23(31)17-25(34)32(21,22)8/h11,13,15,18-20,22-23,25-27,34-36H,9-10,12,14,16-17H2,1-8H3/t18-,19-,20+,22+,23-,25+,26+,27-,30-,31+,32-/m0/s1 |
| InChIKey | SXUJYCUCLFTRKW-QCQONPKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylocarpus granatum (ncbitaxon:241841) | rind (BTO:0001184) | DOI (10.1002/hlca.200800177) | Dried fruit rinds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Protoxylocarpin B (CHEBI:66781) has role metabolite (CHEBI:25212) |
| Protoxylocarpin B (CHEBI:66781) is a limonoid (CHEBI:39434) |
| Synonym | Source |
|---|---|
| (5R,7R,8R,9R,10R,13S,17S)-17-((2S,3S,5R)-5-((1R)-1,2-dihydroxy-2-methylpropyl)-2-ethoxytetrahydrofuran-3-yl)-4,5,6,7,8,9,10,11,12,13,16,17-dodecahydro-7-hydroxy-4,4,8,10,13-pentamethyl-3H-cyclopenta[a]phenanthren-3-one | ChEBI |