EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O2 |
| Net Charge | 0 |
| Average Mass | 228.291 |
| Monoisotopic Mass | 228.11503 |
| SMILES | [H][C@@]1(C(C=C)c2ccccc2)C[C@@H](O)C=CC1=O |
| InChI | InChI=1S/C15H16O2/c1-2-13(11-6-4-3-5-7-11)14-10-12(16)8-9-15(14)17/h2-9,12-14,16H,1,10H2/t12-,13?,14-/m0/s1 |
| InChIKey | RTLQJCZEXLLNLE-HPNRGHHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:746) | - | PubMed (15974608) | Nepalese propolis is a resinous substance collected by bees from various plants |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Propolis neoflavonoid 1 (CHEBI:66778) has role metabolite (CHEBI:25212) |
| Propolis neoflavonoid 1 (CHEBI:66778) is a olefinic compound (CHEBI:78840) |
| Synonym | Source |
|---|---|
| (4R,6S)-4-hydroxy-6-(1-phenylprop-2-enyl)cyclohex-2-en-1-one | ChEBI |
| Citations |
|---|