EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O4 |
| Net Charge | 0 |
| Average Mass | 310.434 |
| Monoisotopic Mass | 310.21441 |
| SMILES | CCCC[C@H](O)/C=C/C=C/C(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O4/c1-2-3-11-16(19)13-9-10-14-17(20)12-7-5-4-6-8-15-18(21)22/h9-10,13-14,16,19H,2-8,11-12,15H2,1H3,(H,21,22)/b13-9+,14-10+/t16-/m0/s1 |
| InChIKey | GDCBVHSUEZTUIW-NRJQCZOGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pleurocybella porrigens (ncbitaxon:71910) | - | PubMed (18057752) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Porrigenic acid (CHEBI:66776) is a hydroxy fatty acid (CHEBI:24654) |
| Porrigenic acid (CHEBI:66776) is a octadecanoid (CHEBI:36326) |
| Porrigenic acid (CHEBI:66776) is a oxo fatty acid (CHEBI:59644) |
| Synonym | Source |
|---|---|
| (14S)-(10E,12E)-14-hydroxy-9-oxo-10,12-octadecadienoic acid | ChEBI |
| Citations |
|---|