EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO5 |
| Net Charge | 0 |
| Average Mass | 401.503 |
| Monoisotopic Mass | 401.22022 |
| SMILES | [H][C@]12CCC3=C4[C@]5(C[C@@H](C(=O)OC)[C@@]4([H])CC3)[C@@]1(CO)C=C[C@]1(O)[C@H](C)CN(C2)[C@]51O |
| InChI | InChI=1S/C23H31NO5/c1-13-10-24-11-15-5-3-14-4-6-16-17(19(26)29-2)9-21(18(14)16)20(15,12-25)7-8-22(13,27)23(21,24)28/h7-8,13,15-17,25,27-28H,3-6,9-12H2,1-2H3/t13-,15-,16-,17-,20-,21-,22+,23+/m1/s1 |
| InChIKey | STEHXMPTKMFKML-MXJQEVSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphniphyllum macropodum (ncbitaxon:276776) | leaf (BTO:0000713) | PubMed (17708656) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pordamacrine A, (rel)- (CHEBI:66774) has role metabolite (CHEBI:25212) |
| Pordamacrine A, (rel)- (CHEBI:66774) is a sesquiterpenoid (CHEBI:26658) |
| Citations |
|---|